C30H31ClN4O2S — CID 133157179
1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157179) has the molecular formula C30H31ClN4O2S and a molecular weight of 547.12 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157179 |
| Molecular Formula | C30H31ClN4O2S |
| Molecular Weight | 547.12 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(C)c3)c2C)cc1Cl |
| InChI | InChI=1S/C30H31ClN4O2S/c1-19-8-7-9-22(16-19)34-20(2)17-24(21(34)3)29-28(26-10-5-6-13-32-26)33-30(38)35(29)23-11-12-27(25(31)18-23)37-15-14-36-4/h5-13,16-18,28-29H,14-15H2,1-4H3,(H,33,38) |
| InChIKey | WYXFOKTULUEMRV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.12 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|