C28H25ClN4O3S — CID 100512942
3-[3-[(4S,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoic acid (PubChem CID 100512942) has the molecular formula C28H25ClN4O3S and a molecular weight of 533.05 g/mol. Its IUPAC name is 3-[3-[(4S,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoic acid.
| Compound Name | 3-[3-[(4S,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 100512942 |
| Molecular Formula | C28H25ClN4O3S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 3-[3-[(4S,5S)-3-(3-chloro-4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]-2,5-dimethylpyrrol-1-yl]benzoic acid |
| SMILES | COc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cc(C)n(-c3cccc(C(=O)O)c3)c2C)cc1Cl |
| InChI | InChI=1S/C28H25ClN4O3S/c1-16-13-21(17(2)32(16)19-8-6-7-18(14-19)27(34)35)26-25(23-9-4-5-12-30-23)31-28(37)33(26)20-10-11-24(36-3)22(29)15-20/h4-15,25-26H,1-3H3,(H,31,37)(H,34,35)/t25-,26+/m1/s1 |
| InChIKey | UHKVJBYDMQACKS-FTJBHMTQSA-N |
| XLogP | 6.03 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|