C28H27ClN4S — CID 133158047
5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158047) has the molecular formula C28H27ClN4S and a molecular weight of 487.07 g/mol. Its IUPAC name is 5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158047 |
| Molecular Formula | C28H27ClN4S |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-(3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3cccc(Cl)c3C)c2C)c1 |
| InChI | InChI=1S/C28H27ClN4S/c1-17-9-7-10-21(15-17)33-27(26(31-28(33)34)24-12-5-6-14-30-24)22-16-18(2)32(20(22)4)25-13-8-11-23(29)19(25)3/h5-16,26-27H,1-4H3,(H,31,34) |
| InChIKey | PSWZRQOLCHBYFF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|