C33H35Cl2N5S — CID 100519342
(4R,5R)-5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100519342) has the molecular formula C33H35Cl2N5S and a molecular weight of 604.65 g/mol. Its IUPAC name is (4R,5R)-5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100519342 |
| Molecular Formula | C33H35Cl2N5S |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | (4R,5R)-5-[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1c(Cl)cccc1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)c1C |
| InChI | InChI=1S/C33H35Cl2N5S/c1-20-13-16-38(17-14-20)30-12-11-24(19-27(30)35)40-32(31(37-33(40)41)28-9-5-6-15-36-28)25-18-21(2)39(23(25)4)29-10-7-8-26(34)22(29)3/h5-12,15,18-20,31-32H,13-14,16-17H2,1-4H3,(H,37,41)/t31-,32+/m0/s1 |
| InChIKey | GSLDPSGGNOCLIX-AJQTZOPKSA-N |
| XLogP | 8.52 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|