C31H38ClN5S — CID 100517973
(4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100517973) has the molecular formula C31H38ClN5S and a molecular weight of 548.20 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100517973 |
| Molecular Formula | C31H38ClN5S |
| Molecular Weight | 548.20 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)c(C)n1C1CCCC1 |
| InChI | InChI=1S/C31H38ClN5S/c1-20-13-16-35(17-14-20)28-12-11-24(19-26(28)32)37-30(29(34-31(37)38)27-10-6-7-15-33-27)25-18-21(2)36(22(25)3)23-8-4-5-9-23/h6-7,10-12,15,18-20,23,29-30H,4-5,8-9,13-14,16-17H2,1-3H3,(H,34,38)/t29-,30+/m0/s1 |
| InChIKey | QYROUCRGMCLNMX-XZWHSSHBSA-N |
| XLogP | 7.68 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.20 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|