C34H38ClN5S — CID 100519116
(4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100519116) has the molecular formula C34H38ClN5S and a molecular weight of 584.23 g/mol. Its IUPAC name is (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100519116 |
| Molecular Formula | C34H38ClN5S |
| Molecular Weight | 584.23 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccc(-n2c(C)cc([C@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(N4CCC(C)CC4)c(Cl)c3)c2C)c1C |
| InChI | InChI=1S/C34H38ClN5S/c1-21-14-17-38(18-15-21)31-13-12-26(20-28(31)35)40-33(32(37-34(40)41)29-10-6-7-16-36-29)27-19-23(3)39(25(27)5)30-11-8-9-22(2)24(30)4/h6-13,16,19-21,32-33H,14-15,17-18H2,1-5H3,(H,37,41)/t32-,33+/m1/s1 |
| InChIKey | XIKWMJARSBDGBH-SAIUNTKASA-N |
| XLogP | 8.17 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.23 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|