C32H33BrClN5S — CID 133241749
5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133241749) has the molecular formula C32H33BrClN5S and a molecular weight of 635.08 g/mol. Its IUPAC name is 5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133241749 |
| Molecular Formula | C32H33BrClN5S |
| Molecular Weight | 635.08 g/mol |
| Exact Mass | 633.13 |
| IUPAC Name | 5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C32H33BrClN5S/c1-20-12-15-37(16-13-20)29-11-10-25(19-27(29)34)39-31(30(36-32(39)40)28-9-4-5-14-35-28)26-17-21(2)38(22(26)3)24-8-6-7-23(33)18-24/h4-11,14,17-20,30-31H,12-13,15-16H2,1-3H3,(H,36,40) |
| InChIKey | UQJKHYYWPLQZQU-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.08 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|