C32H35ClN6S — CID 100519648
(4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100519648) has the molecular formula C32H35ClN6S and a molecular weight of 571.19 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100519648 |
| Molecular Formula | C32H35ClN6S |
| Molecular Weight | 571.19 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccnc1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)c1C |
| InChI | InChI=1S/C32H35ClN6S/c1-20-12-16-37(17-13-20)28-11-10-24(19-26(28)33)39-30(29(36-32(39)40)27-9-5-6-14-34-27)25-18-22(3)38(23(25)4)31-21(2)8-7-15-35-31/h5-11,14-15,18-20,29-30H,12-13,16-17H2,1-4H3,(H,36,40)/t29-,30+/m0/s1 |
| InChIKey | LCFGCDOHKORODG-XZWHSSHBSA-N |
| XLogP | 7.26 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.19 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|