C35H40ClN5S — CID 125077366
(4R,5R)-1-[3-chloro-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125077366) has the molecular formula C35H40ClN5S and a molecular weight of 598.26 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125077366 |
| Molecular Formula | C35H40ClN5S |
| Molecular Weight | 598.26 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-(2,3-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(N4C[C@@H](C)C[C@H](C)C4)c(Cl)c3)c2C)c1C |
| InChI | InChI=1S/C35H40ClN5S/c1-21-16-22(2)20-39(19-21)32-14-13-27(18-29(32)36)41-34(33(38-35(41)42)30-11-7-8-15-37-30)28-17-24(4)40(26(28)6)31-12-9-10-23(3)25(31)5/h7-15,17-18,21-22,33-34H,16,19-20H2,1-6H3,(H,38,42)/t21-,22-,33-,34+/m0/s1 |
| InChIKey | FLZBIWRDKRMRBN-GNIPUNEXSA-N |
| XLogP | 8.42 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.26 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|