C37H45ClN6S — CID 125081564
(4R,5R)-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125081564) has the molecular formula C37H45ClN6S and a molecular weight of 641.33 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125081564 |
| Molecular Formula | C37H45ClN6S |
| Molecular Weight | 641.33 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]phenyl]-5-[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(N4C[C@H](C)C[C@@H](C)C4)c(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C37H45ClN6S/c1-7-41(8-2)28-12-14-29(15-13-28)43-26(5)20-31(27(43)6)36-35(33-11-9-10-18-39-33)40-37(45)44(36)30-16-17-34(32(38)21-30)42-22-24(3)19-25(4)23-42/h9-18,20-21,24-25,35-36H,7-8,19,22-23H2,1-6H3,(H,40,45)/t24-,25-,35+,36-/m1/s1 |
| InChIKey | YBXRWHFILGLTIN-PRGAFZJDSA-N |
| XLogP | 8.65 |
| TPSA | 39.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.33 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|