C30H38ClN5OS — CID 133157517
1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157517) has the molecular formula C30H38ClN5OS and a molecular weight of 552.19 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157517 |
| Molecular Formula | C30H38ClN5OS |
| Molecular Weight | 552.19 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCn1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(N3CC(C)CC(C)C3)c(Cl)c2)c1C |
| InChI | InChI=1S/C30H38ClN5OS/c1-19-14-20(2)18-34(17-19)27-10-9-23(16-25(27)31)36-29(24-15-21(3)35(22(24)4)12-13-37-5)28(33-30(36)38)26-8-6-7-11-32-26/h6-11,15-16,19-20,28-29H,12-14,17-18H2,1-5H3,(H,33,38) |
| InChIKey | OUHQCYNBCXZNIN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.19 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|