C31H32ClN5S — CID 100521709
(4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100521709) has the molecular formula C31H32ClN5S and a molecular weight of 542.15 g/mol. Its IUPAC name is (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100521709 |
| Molecular Formula | C31H32ClN5S |
| Molecular Weight | 542.15 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C31H32ClN5S/c1-21-15-18-35(19-16-21)27-14-12-24(20-25(27)32)37-30(29(34-31(37)38)26-10-6-7-17-33-26)28-13-11-22(2)36(28)23-8-4-3-5-9-23/h3-14,17,20-21,29-30H,15-16,18-19H2,1-2H3,(H,34,38)/t29-,30+/m1/s1 |
| InChIKey | XRFXHKGIOIIOFV-IHLOFXLRSA-N |
| XLogP | 7.25 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.15 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|