C30H29Cl2N5S — CID 100517365
(4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100517365) has the molecular formula C30H29Cl2N5S and a molecular weight of 562.57 g/mol. Its IUPAC name is (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100517365 |
| Molecular Formula | C30H29Cl2N5S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-chlorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@H](c4ccccn4)[C@H]3c3cccn3-c3cccc(Cl)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C30H29Cl2N5S/c1-20-12-16-35(17-13-20)26-11-10-23(19-24(26)32)37-29(28(34-30(37)38)25-8-2-3-14-33-25)27-9-5-15-36(27)22-7-4-6-21(31)18-22/h2-11,14-15,18-20,28-29H,12-13,16-17H2,1H3,(H,34,38)/t28-,29-/m1/s1 |
| InChIKey | OYGAJUOJJSMPKM-FQLXRVMXSA-N |
| XLogP | 7.59 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|