C32H34ClN5S — CID 133157498
1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157498) has the molecular formula C32H34ClN5S and a molecular weight of 556.18 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157498 |
| Molecular Formula | C32H34ClN5S |
| Molecular Weight | 556.18 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[1-(3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(N3CC(C)CC(C)C3)c(Cl)c2)c1 |
| InChI | InChI=1S/C32H34ClN5S/c1-21-8-6-9-24(17-21)37-15-7-11-29(37)31-30(27-10-4-5-14-34-27)35-32(39)38(31)25-12-13-28(26(33)18-25)36-19-22(2)16-23(3)20-36/h4-15,17-18,22-23,30-31H,16,19-20H2,1-3H3,(H,35,39) |
| InChIKey | DEPFUWCZXIUMPG-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.18 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|