C30H29ClFN5S — CID 133241796
1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133241796) has the molecular formula C30H29ClFN5S and a molecular weight of 546.12 g/mol. Its IUPAC name is 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133241796 |
| Molecular Formula | C30H29ClFN5S |
| Molecular Weight | 546.12 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(4-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3cccn3-c3ccc(F)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C30H29ClFN5S/c1-20-13-17-35(18-14-20)26-12-11-23(19-24(26)31)37-29(28(34-30(37)38)25-5-2-3-15-33-25)27-6-4-16-36(27)22-9-7-21(32)8-10-22/h2-12,15-16,19-20,28-29H,13-14,17-18H2,1H3,(H,34,38) |
| InChIKey | OGFPBNZYVOMBRK-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.12 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|