C29H34ClN5S — CID 100517735
(4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100517735) has the molecular formula C29H34ClN5S and a molecular weight of 520.15 g/mol. Its IUPAC name is (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100517735 |
| Molecular Formula | C29H34ClN5S |
| Molecular Weight | 520.15 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (4S,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@H](c4ccccn4)[C@H]3c3cccn3C3CCCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C29H34ClN5S/c1-20-13-17-33(18-14-20)25-12-11-22(19-23(25)30)35-28(26-10-6-16-34(26)21-7-2-3-8-21)27(32-29(35)36)24-9-4-5-15-31-24/h4-6,9-12,15-16,19-21,27-28H,2-3,7-8,13-14,17-18H2,1H3,(H,32,36)/t27-,28-/m1/s1 |
| InChIKey | MSEUCZDBZXCHIU-VSGBNLITSA-N |
| XLogP | 7.07 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.15 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|