C30H36ClN5S — CID 125081808
(4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125081808) has the molecular formula C30H36ClN5S and a molecular weight of 534.17 g/mol. Its IUPAC name is (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125081808 |
| Molecular Formula | C30H36ClN5S |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (4S,5R)-1-[3-chloro-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]phenyl]-5-(1-cyclopentylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(N3C(=S)N[C@H](c4ccccn4)[C@@H]3c3cccn3C3CCCC3)cc2Cl)C1 |
| InChI | InChI=1S/C30H36ClN5S/c1-20-16-21(2)19-34(18-20)26-13-12-23(17-24(26)31)36-29(27-11-7-15-35(27)22-8-3-4-9-22)28(33-30(36)37)25-10-5-6-14-32-25/h5-7,10-15,17,20-22,28-29H,3-4,8-9,16,18-19H2,1-2H3,(H,33,37)/t20-,21+,28-,29+/m1/s1 |
| InChIKey | ZUDFMSAZQDWKEB-XTRXHUIHSA-N |
| XLogP | 7.31 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|