C31H30ClFN4OS — CID 133157599
1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157599) has the molecular formula C31H30ClFN4OS and a molecular weight of 561.13 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157599 |
| Molecular Formula | C31H30ClFN4OS |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(4-fluorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CC(C)CN(c2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(-c4ccc(F)cc4)o3)cc2Cl)C1 |
| InChI | InChI=1S/C31H30ClFN4OS/c1-19-15-20(2)18-36(17-19)26-11-10-23(16-24(26)32)37-30(29(35-31(37)39)25-5-3-4-14-34-25)28-13-12-27(38-28)21-6-8-22(33)9-7-21/h3-14,16,19-20,29-30H,15,17-18H2,1-2H3,(H,35,39) |
| InChIKey | GNWCGLAHPJCLBT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|