C30H28Cl2N4OS — CID 100520782
(4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100520782) has the molecular formula C30H28Cl2N4OS and a molecular weight of 563.55 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100520782 |
| Molecular Formula | C30H28Cl2N4OS |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(4-chlorophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@@H]3c3ccc(-c4ccc(Cl)cc4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C30H28Cl2N4OS/c1-19-13-16-35(17-14-19)25-10-9-22(18-23(25)32)36-29(28(34-30(36)38)24-4-2-3-15-33-24)27-12-11-26(37-27)20-5-7-21(31)8-6-20/h2-12,15,18-19,28-29H,13-14,16-17H2,1H3,(H,34,38)/t28-,29-/m0/s1 |
| InChIKey | DGIOZCYSQQXCKK-VMPREFPWSA-N |
| XLogP | 8.06 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|