C32H32Cl2N4OS — CID 133157617
1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157617) has the molecular formula C32H32Cl2N4OS and a molecular weight of 591.61 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157617 |
| Molecular Formula | C32H32Cl2N4OS |
| Molecular Weight | 591.61 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 1-[3-chloro-4-(3,5-dimethylpiperidin-1-yl)phenyl]-5-[5-(5-chloro-2-methylphenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(C2C(c3ccccn3)NC(=S)N2c2ccc(N3CC(C)CC(C)C3)c(Cl)c2)o1 |
| InChI | InChI=1S/C32H32Cl2N4OS/c1-19-14-20(2)18-37(17-19)27-10-9-23(16-25(27)34)38-31(30(36-32(38)40)26-6-4-5-13-35-26)29-12-11-28(39-29)24-15-22(33)8-7-21(24)3/h4-13,15-16,19-20,30-31H,14,17-18H2,1-3H3,(H,36,40) |
| InChIKey | MCCQSYXFCYKGBG-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.61 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|