C27H32ClN5S — CID 100519762
(4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-propan-2-ylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100519762) has the molecular formula C27H32ClN5S and a molecular weight of 494.11 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-propan-2-ylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-propan-2-ylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100519762 |
| Molecular Formula | C27H32ClN5S |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(1-propan-2-ylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@@H]3c3cccn3C(C)C)cc2Cl)CC1 |
| InChI | InChI=1S/C27H32ClN5S/c1-18(2)32-14-6-8-24(32)26-25(22-7-4-5-13-29-22)30-27(34)33(26)20-9-10-23(21(28)17-20)31-15-11-19(3)12-16-31/h4-10,13-14,17-19,25-26H,11-12,15-16H2,1-3H3,(H,30,34)/t25-,26-/m0/s1 |
| InChIKey | FNAWQSSJDMNYOO-UIOOFZCWSA-N |
| XLogP | 6.53 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|