C29H30ClN5OS — CID 100517673
(4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100517673) has the molecular formula C29H30ClN5OS and a molecular weight of 532.11 g/mol. Its IUPAC name is (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100517673 |
| Molecular Formula | C29H30ClN5OS |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | (4R,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(furan-2-ylmethyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@@H]3c3cccn3Cc3ccco3)cc2Cl)CC1 |
| InChI | InChI=1S/C29H30ClN5OS/c1-20-11-15-33(16-12-20)25-10-9-21(18-23(25)30)35-28(27(32-29(35)37)24-7-2-3-13-31-24)26-8-4-14-34(26)19-22-6-5-17-36-22/h2-10,13-14,17-18,20,27-28H,11-12,15-16,19H2,1H3,(H,32,37)/t27-,28-/m0/s1 |
| InChIKey | TZIZNSJVIFUXLB-NSOVKSMOSA-N |
| XLogP | 6.59 |
| TPSA | 49.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|