C30H29ClN6O2S — CID 100520392
(4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100520392) has the molecular formula C30H29ClN6O2S and a molecular weight of 573.12 g/mol. Its IUPAC name is (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100520392 |
| Molecular Formula | C30H29ClN6O2S |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1CCN(c2ccc(N3C(=S)N[C@@H](c4ccccn4)[C@H]3c3cccn3-c3cccc([N+](=O)[O-])c3)cc2Cl)CC1 |
| InChI | InChI=1S/C30H29ClN6O2S/c1-20-12-16-34(17-13-20)26-11-10-22(19-24(26)31)36-29(28(33-30(36)40)25-8-2-3-14-32-25)27-9-5-15-35(27)21-6-4-7-23(18-21)37(38)39/h2-11,14-15,18-20,28-29H,12-13,16-17H2,1H3,(H,33,40)/t28-,29+/m0/s1 |
| InChIKey | GLSHOGKNICWMGE-URLMMPGGSA-N |
| XLogP | 6.85 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|