C26H23ClN4OS — CID 133224583
1-(3-chloro-4-methoxyphenyl)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224583) has the molecular formula C26H23ClN4OS and a molecular weight of 475.02 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224583 |
| Molecular Formula | C26H23ClN4OS |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-5-(5-methyl-1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(C)n2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C26H23ClN4OS/c1-17-11-13-22(30(17)18-8-4-3-5-9-18)25-24(21-10-6-7-15-28-21)29-26(33)31(25)19-12-14-23(32-2)20(27)16-19/h3-16,24-25H,1-2H3,(H,29,33) |
| InChIKey | DKOKLARPFLDBBL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|