C20H18ClN3OS2 — CID 133224433
1-(3-chloro-4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224433) has the molecular formula C20H18ClN3OS2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224433 |
| Molecular Formula | C20H18ClN3OS2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-5-(5-methylthiophen-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(C)s2)cc1Cl |
| InChI | InChI=1S/C20H18ClN3OS2/c1-12-6-9-17(27-12)19-18(15-5-3-4-10-22-15)23-20(26)24(19)13-7-8-16(25-2)14(21)11-13/h3-11,18-19H,1-2H3,(H,23,26) |
| InChIKey | MBRQWGIYGNUHCC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|