C21H20ClIN4OS — CID 100510778
(4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100510778) has the molecular formula C21H20ClIN4OS and a molecular weight of 538.84 g/mol. Its IUPAC name is (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100510778 |
| Molecular Formula | C21H20ClIN4OS |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | (4R,5R)-1-(3-chloro-4-methoxyphenyl)-5-(4-iodo-2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2c(C)[nH]c(C)c2I)cc1Cl |
| InChI | InChI=1S/C21H20ClIN4OS/c1-11-17(18(23)12(2)25-11)20-19(15-6-4-5-9-24-15)26-21(29)27(20)13-7-8-16(28-3)14(22)10-13/h4-10,19-20,25H,1-3H3,(H,26,29)/t19-,20+/m0/s1 |
| InChIKey | UFJBOHPVRWQFHE-VQTJNVASSA-N |
| XLogP | 5.47 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|