C21H21ClN4OS — CID 133224466
1-(3-chloro-4-methoxyphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224466) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224466 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(C)n2C)cc1Cl |
| InChI | InChI=1S/C21H21ClN4OS/c1-13-7-9-17(25(13)2)20-19(16-6-4-5-11-23-16)24-21(28)26(20)14-8-10-18(27-3)15(22)12-14/h4-12,19-20H,1-3H3,(H,24,28) |
| InChIKey | JOHHNXJGAUTRPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|