C27H25ClN4O2S — CID 100515744
(4S,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100515744) has the molecular formula C27H25ClN4O2S and a molecular weight of 505.04 g/mol. Its IUPAC name is (4S,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100515744 |
| Molecular Formula | C27H25ClN4O2S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | (4S,5S)-1-(3-chloro-4-methoxyphenyl)-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(-n2c(C)ccc2[C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H25ClN4O2S/c1-17-7-13-23(31(17)18-8-11-20(33-2)12-9-18)26-25(22-6-4-5-15-29-22)30-27(35)32(26)19-10-14-24(34-3)21(28)16-19/h4-16,25-26H,1-3H3,(H,30,35)/t25-,26-/m1/s1 |
| InChIKey | QKZKTOGNNHFAOF-CLJLJLNGSA-N |
| XLogP | 6.03 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|