C25H28N4OS — CID 100527860
(4S,5S)-1-cyclopentyl-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100527860) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is (4S,5S)-1-cyclopentyl-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-cyclopentyl-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100527860 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (4S,5S)-1-cyclopentyl-5-[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(-n2c(C)ccc2[C@@H]2[C@@H](c3ccccn3)NC(=S)N2C2CCCC2)cc1 |
| InChI | InChI=1S/C25H28N4OS/c1-17-10-15-22(28(17)19-11-13-20(30-2)14-12-19)24-23(21-9-5-6-16-26-21)27-25(31)29(24)18-7-3-4-8-18/h5-6,9-16,18,23-24H,3-4,7-8H2,1-2H3,(H,27,31)/t23-,24-/m1/s1 |
| InChIKey | IIWMGDHHQXFFOS-DNQXCXABSA-N |
| XLogP | 5.10 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|