C27H33N5S — CID 100525051
(4R,5S)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100525051) has the molecular formula C27H33N5S and a molecular weight of 459.66 g/mol. Its IUPAC name is (4R,5S)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100525051 |
| Molecular Formula | C27H33N5S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (4R,5S)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)c(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H33N5S/c1-18-17-23(19(2)31(18)22-14-12-20(13-15-22)30(3)4)26-25(24-11-7-8-16-28-24)29-27(33)32(26)21-9-5-6-10-21/h7-8,11-17,21,25-26H,5-6,9-10H2,1-4H3,(H,29,33)/t25-,26-/m0/s1 |
| InChIKey | FNJYDBMETCLBRU-UIOOFZCWSA-N |
| XLogP | 5.47 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|