C25H27BrN4S — CID 100524733
(4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100524733) has the molecular formula C25H27BrN4S and a molecular weight of 495.49 g/mol. Its IUPAC name is (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100524733 |
| Molecular Formula | C25H27BrN4S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-cyclopentyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C25H27BrN4S/c1-16-14-21(17(2)29(16)20-11-7-8-18(26)15-20)24-23(22-12-5-6-13-27-22)28-25(31)30(24)19-9-3-4-10-19/h5-8,11-15,19,23-24H,3-4,9-10H2,1-2H3,(H,28,31)/t23-,24+/m0/s1 |
| InChIKey | LUACHVLJCQJQCP-BJKOFHAPSA-N |
| XLogP | 6.17 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|