C28H34N4S — CID 100525653
(4S,5S)-1-cyclopentyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100525653) has the molecular formula C28H34N4S and a molecular weight of 458.68 g/mol. Its IUPAC name is (4S,5S)-1-cyclopentyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-cyclopentyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100525653 |
| Molecular Formula | C28H34N4S |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (4S,5S)-1-cyclopentyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1cccc(C)c1-n1c(C)cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2C2CCCC2)c1C |
| InChI | InChI=1S/C28H34N4S/c1-5-21-12-10-11-18(2)26(21)31-19(3)17-23(20(31)4)27-25(24-15-8-9-16-29-24)30-28(33)32(27)22-13-6-7-14-22/h8-12,15-17,22,25,27H,5-7,13-14H2,1-4H3,(H,30,33)/t25-,27+/m1/s1 |
| InChIKey | KUIBZQIAJYCNCR-VPUSJEBWSA-N |
| XLogP | 6.28 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|