C25H30N4S — CID 133221603
1-ethyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133221603) has the molecular formula C25H30N4S and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-ethyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-ethyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133221603 |
| Molecular Formula | C25H30N4S |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-ethyl-5-[1-(2-ethyl-6-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCc1cccc(C)c1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2CC)c1C |
| InChI | InChI=1S/C25H30N4S/c1-6-19-12-10-11-16(3)23(19)29-17(4)15-20(18(29)5)24-22(21-13-8-9-14-26-21)27-25(30)28(24)7-2/h8-15,22,24H,6-7H2,1-5H3,(H,27,30) |
| InChIKey | DKVIBVLQSVZHKS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|