C27H24BrFN4S — CID 100500587
(4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100500587) has the molecular formula C27H24BrFN4S and a molecular weight of 535.49 g/mol. Its IUPAC name is (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100500587 |
| Molecular Formula | C27H24BrFN4S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | (4R,5R)-5-[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cc(C)n(-c3cccc(Br)c3)c2C)ccc1F |
| InChI | InChI=1S/C27H24BrFN4S/c1-16-13-21(10-11-23(16)29)33-26(25(31-27(33)34)24-9-4-5-12-30-24)22-14-17(2)32(18(22)3)20-8-6-7-19(28)15-20/h4-15,25-26H,1-3H3,(H,31,34)/t25-,26+/m0/s1 |
| InChIKey | SFUSZGFSBZHVAZ-IZZNHLLZSA-N |
| XLogP | 6.88 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|