C27H24F2N4S — CID 133224160
1-(4-fluoro-3-methylphenyl)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224160) has the molecular formula C27H24F2N4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224160 |
| Molecular Formula | C27H24F2N4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-5-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(-c3ccc(F)cc3)c2C)ccc1F |
| InChI | InChI=1S/C27H24F2N4S/c1-16-14-21(11-12-23(16)29)33-26(25(31-27(33)34)24-6-4-5-13-30-24)22-15-17(2)32(18(22)3)20-9-7-19(28)8-10-20/h4-15,25-26H,1-3H3,(H,31,34) |
| InChIKey | JWFSEBUFPUCRBB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|