C19H24N4S — CID 100523581
(4R,5R)-1-cyclopentyl-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100523581) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is (4R,5R)-1-cyclopentyl-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-cyclopentyl-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100523581 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (4R,5R)-1-cyclopentyl-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc([C@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)n1C |
| InChI | InChI=1S/C19H24N4S/c1-13-10-11-16(22(13)2)18-17(15-9-5-6-12-20-15)21-19(24)23(18)14-7-3-4-8-14/h5-6,9-12,14,17-18H,3-4,7-8H2,1-2H3,(H,21,24)/t17-,18-/m0/s1 |
| InChIKey | HEJGQMZXKSWCJV-ROUUACIJSA-N |
| XLogP | 3.64 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|