C25H29N5S — CID 100526016
(4R,5R)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100526016) has the molecular formula C25H29N5S and a molecular weight of 431.61 g/mol. Its IUPAC name is (4R,5R)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100526016 |
| Molecular Formula | C25H29N5S |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (4R,5R)-1-cyclopentyl-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)c1ccc(-n2cccc2[C@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)cc1 |
| InChI | InChI=1S/C25H29N5S/c1-28(2)18-12-14-19(15-13-18)29-17-7-11-22(29)24-23(21-10-5-6-16-26-21)27-25(31)30(24)20-8-3-4-9-20/h5-7,10-17,20,23-24H,3-4,8-9H2,1-2H3,(H,27,31)/t23-,24-/m0/s1 |
| InChIKey | XSSOLRTVVMXDHF-ZEQRLZLVSA-N |
| XLogP | 4.85 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|