C26H24ClN5S — CID 133182588
1-(4-chlorophenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182588) has the molecular formula C26H24ClN5S and a molecular weight of 474.03 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-chlorophenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182588 |
| Molecular Formula | C26H24ClN5S |
| Molecular Weight | 474.03 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)c1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24ClN5S/c1-30(2)19-12-14-20(15-13-19)31-17-5-7-23(31)25-24(22-6-3-4-16-28-22)29-26(33)32(25)21-10-8-18(27)9-11-21/h3-17,24-25H,1-2H3,(H,29,33) |
| InChIKey | YFAVOLUYUMVIQU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|