C27H27N5OS — CID 133156470
1-[4-(dimethylamino)phenyl]-5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156470) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[4-(dimethylamino)phenyl]-5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156470 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1-n1cccc1C1C(c2ccccn2)NC(=S)N1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H27N5OS/c1-30(2)19-13-15-20(16-14-19)32-26(25(29-27(32)34)21-9-6-7-17-28-21)23-11-8-18-31(23)22-10-4-5-12-24(22)33-3/h4-18,25-26H,1-3H3,(H,29,34) |
| InChIKey | YVIJDDDKEWYSGO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|