C26H24N4OS — CID 133157824
5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157824) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157824 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1-n1cccc1C1C(c2ccccn2)NC(=S)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C26H24N4OS/c1-18-12-14-19(15-13-18)30-25(24(28-26(30)32)20-8-5-6-16-27-20)22-10-7-17-29(22)21-9-3-4-11-23(21)31-2/h3-17,24-25H,1-2H3,(H,28,32) |
| InChIKey | ILJHSEJUWHCCNW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|