C25H22N4S — CID 133157895
1-(4-methylphenyl)-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157895) has the molecular formula C25H22N4S and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-methylphenyl)-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157895 |
| Molecular Formula | C25H22N4S |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-(4-methylphenyl)-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4S/c1-18-12-14-20(15-13-18)29-24(23(27-25(29)30)21-10-5-6-16-26-21)22-11-7-17-28(22)19-8-3-2-4-9-19/h2-17,23-24H,1H3,(H,27,30) |
| InChIKey | CCLCBINVJHOVNN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|