C30H25N5OS — CID 133183689
1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione (PubChem CID 133183689) has the molecular formula C30H25N5OS and a molecular weight of 503.63 g/mol. Its IUPAC name is 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione.
| Compound Name | 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133183689 |
| Molecular Formula | C30H25N5OS |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[4-(4-methylphenoxy)phenyl]-4-pyridin-2-yl-5-(1-pyridin-4-ylpyrrol-2-yl)imidazolidine-2-thione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=S)NC(c4ccccn4)C3c3cccn3-c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C30H25N5OS/c1-21-7-11-24(12-8-21)36-25-13-9-23(10-14-25)35-29(28(33-30(35)37)26-5-2-3-17-32-26)27-6-4-20-34(27)22-15-18-31-19-16-22/h2-20,28-29H,1H3,(H,33,37) |
| InChIKey | BCJSZWBKEVXEIQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|