C30H23N5O3S — CID 133183448
5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183448) has the molecular formula C30H23N5O3S and a molecular weight of 533.61 g/mol. Its IUPAC name is 5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183448 |
| Molecular Formula | C30H23N5O3S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H23N5O3S/c36-35(37)23-13-11-21(12-14-23)33-20-6-10-27(33)29-28(26-9-4-5-19-31-26)32-30(39)34(29)22-15-17-25(18-16-22)38-24-7-2-1-3-8-24/h1-20,28-29H,(H,32,39) |
| InChIKey | GEWVRSWGOBTPDO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|