C25H20FN5O2S — CID 100502399
(4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100502399) has the molecular formula C25H20FN5O2S and a molecular weight of 473.53 g/mol. Its IUPAC name is (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100502399 |
| Molecular Formula | C25H20FN5O2S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2ccc([N+](=O)[O-])cc2)ccc1F |
| InChI | InChI=1S/C25H20FN5O2S/c1-16-15-19(11-12-20(16)26)30-24(23(28-25(30)34)21-5-2-3-13-27-21)22-6-4-14-29(22)17-7-9-18(10-8-17)31(32)33/h2-15,23-24H,1H3,(H,28,34)/t23-,24+/m0/s1 |
| InChIKey | HECPNSCMXQBRMT-BJKOFHAPSA-N |
| XLogP | 5.41 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|