C26H23FN4OS — CID 100502165
(4S,5R)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100502165) has the molecular formula C26H23FN4OS and a molecular weight of 458.56 g/mol. Its IUPAC name is (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100502165 |
| Molecular Formula | C26H23FN4OS |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (4S,5R)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(-n2cccc2[C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C26H23FN4OS/c1-17-16-19(10-13-21(17)27)31-25(24(29-26(31)33)22-6-3-4-14-28-22)23-7-5-15-30(23)18-8-11-20(32-2)12-9-18/h3-16,24-25H,1-2H3,(H,29,33)/t24-,25+/m1/s1 |
| InChIKey | IVTSNDNOARSEED-RPBOFIJWSA-N |
| XLogP | 5.51 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|