C25H21FN4OS — CID 100502211
(4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100502211) has the molecular formula C25H21FN4OS and a molecular weight of 444.54 g/mol. Its IUPAC name is (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100502211 |
| Molecular Formula | C25H21FN4OS |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (4R,5S)-1-(4-fluoro-3-methylphenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2ccc(O)cc2)ccc1F |
| InChI | InChI=1S/C25H21FN4OS/c1-16-15-18(9-12-20(16)26)30-24(23(28-25(30)32)21-5-2-3-13-27-21)22-6-4-14-29(22)17-7-10-19(31)11-8-17/h2-15,23-24,31H,1H3,(H,28,32)/t23-,24+/m0/s1 |
| InChIKey | VKWINAOEAOIMOV-BJKOFHAPSA-N |
| XLogP | 5.20 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|