C24H19FN4OS — CID 133182440
1-(2-fluorophenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182440) has the molecular formula C24H19FN4OS and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(2-fluorophenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182440 |
| Molecular Formula | C24H19FN4OS |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-(2-fluorophenyl)-5-[1-(4-hydroxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Oc1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccccc2F)cc1 |
| InChI | InChI=1S/C24H19FN4OS/c25-18-6-1-2-8-20(18)29-23(22(27-24(29)31)19-7-3-4-14-26-19)21-9-5-15-28(21)16-10-12-17(30)13-11-16/h1-15,22-23,30H,(H,27,31) |
| InChIKey | LCLSVKVBCRUIMB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|