C27H25N5O3S — CID 100601453
(4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100601453) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is (4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100601453 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-1-(4-propan-2-yloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC(C)Oc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H25N5O3S/c1-18(2)35-22-14-12-20(13-15-22)31-26(25(29-27(31)36)23-6-3-4-16-28-23)24-7-5-17-30(24)19-8-10-21(11-9-19)32(33)34/h3-18,25-26H,1-2H3,(H,29,36)/t25-,26+/m0/s1 |
| InChIKey | KKWJOPIUFCYVDR-IZZNHLLZSA-N |
| XLogP | 5.74 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|