C27H24N6O4S — CID 133243186
2-methoxy-N-[4-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 133243186) has the molecular formula C27H24N6O4S and a molecular weight of 528.59 g/mol. Its IUPAC name is 2-methoxy-N-[4-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133243186 |
| Molecular Formula | C27H24N6O4S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-methoxy-N-[4-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H24N6O4S/c1-37-17-24(34)29-18-7-9-20(10-8-18)32-26(25(30-27(32)38)22-5-2-3-15-28-22)23-6-4-16-31(23)19-11-13-21(14-12-19)33(35)36/h2-16,25-26H,17H2,1H3,(H,29,34)(H,30,38) |
| InChIKey | MGXPTTRLPALLOB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|