C27H23ClN6O4S — CID 100576718
N-[2-chloro-4-[(4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide (PubChem CID 100576718) has the molecular formula C27H23ClN6O4S and a molecular weight of 563.04 g/mol. Its IUPAC name is N-[2-chloro-4-[(4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[2-chloro-4-[(4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 100576718 |
| Molecular Formula | C27H23ClN6O4S |
| Molecular Weight | 563.04 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | N-[2-chloro-4-[(4R,5S)-5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2cccn2-c2ccc([N+](=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C27H23ClN6O4S/c1-38-16-24(35)30-21-12-11-19(15-20(21)28)33-26(25(31-27(33)39)22-5-2-3-13-29-22)23-6-4-14-32(23)17-7-9-18(10-8-17)34(36)37/h2-15,25-26H,16H2,1H3,(H,30,35)(H,31,39)/t25-,26+/m0/s1 |
| InChIKey | RDPXJKWCVLKTOY-IZZNHLLZSA-N |
| XLogP | 5.20 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.04 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|